C12H9Br2NOS2 — CID 83146034
5-bromo-2-[(4-bromothiophen-2-yl)methoxy]benzenecarbothioamide (PubChem CID 83146034) has the molecular formula C12H9Br2NOS2 and a molecular weight of 407.15 g/mol. Its IUPAC name is 5-bromo-2-[(4-bromothiophen-2-yl)methoxy]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[(4-bromothiophen-2-yl)methoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 83146034 |
| Molecular Formula | C12H9Br2NOS2 |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 404.85 |
| IUPAC Name | 5-bromo-2-[(4-bromothiophen-2-yl)methoxy]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(Br)ccc1OCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H9Br2NOS2/c13-7-1-2-11(10(4-7)12(15)17)16-5-9-3-8(14)6-18-9/h1-4,6H,5H2,(H2,15,17) |
| InChIKey | NWXOJJDCKJEYBZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|