C13H12Br2N2S2 — CID 114891555
5-bromo-2-[(4-bromothiophen-2-yl)methyl-methylamino]benzenecarbothioamide (PubChem CID 114891555) has the molecular formula C13H12Br2N2S2 and a molecular weight of 420.20 g/mol. Its IUPAC name is 5-bromo-2-[(4-bromothiophen-2-yl)methyl-methylamino]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[(4-bromothiophen-2-yl)methyl-methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114891555 |
| Molecular Formula | C13H12Br2N2S2 |
| Molecular Weight | 420.20 g/mol |
| Exact Mass | 417.88 |
| IUPAC Name | 5-bromo-2-[(4-bromothiophen-2-yl)methyl-methylamino]benzenecarbothioamide |
| SMILES | CN(Cc1cc(Br)cs1)c1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C13H12Br2N2S2/c1-17(6-10-4-9(15)7-19-10)12-3-2-8(14)5-11(12)13(16)18/h2-5,7H,6H2,1H3,(H2,16,18) |
| InChIKey | GWWCKTQFNKDZBM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|