C13H13Br2N3S — CID 114904502
4-bromo-2-[(4-bromothiophen-2-yl)methyl-methylamino]benzenecarboximidamide (PubChem CID 114904502) has the molecular formula C13H13Br2N3S and a molecular weight of 403.14 g/mol. Its IUPAC name is 4-bromo-2-[(4-bromothiophen-2-yl)methyl-methylamino]benzenecarboximidamide.
| Compound Name | 4-bromo-2-[(4-bromothiophen-2-yl)methyl-methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 114904502 |
| Molecular Formula | C13H13Br2N3S |
| Molecular Weight | 403.14 g/mol |
| Exact Mass | 400.92 |
| IUPAC Name | 4-bromo-2-[(4-bromothiophen-2-yl)methyl-methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Br)cc1N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C13H13Br2N3S/c1-18(6-10-4-9(15)7-19-10)12-5-8(14)2-3-11(12)13(16)17/h2-5,7H,6H2,1H3,(H3,16,17) |
| InChIKey | WHCMUQGJZOLTKA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.14 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|