C12H13ClN4S — CID 63092842
4-chloro-2-[methyl(1,3-thiazol-4-ylmethyl)amino]benzenecarboximidamide (PubChem CID 63092842) has the molecular formula C12H13ClN4S and a molecular weight of 280.78 g/mol. Its IUPAC name is 4-chloro-2-[methyl(1,3-thiazol-4-ylmethyl)amino]benzenecarboximidamide.
| Compound Name | 4-chloro-2-[methyl(1,3-thiazol-4-ylmethyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 63092842 |
| Molecular Formula | C12H13ClN4S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-chloro-2-[methyl(1,3-thiazol-4-ylmethyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cl)cc1N(C)Cc1cscn1 |
| InChI | InChI=1S/C12H13ClN4S/c1-17(5-9-6-18-7-16-9)11-4-8(13)2-3-10(11)12(14)15/h2-4,6-7H,5H2,1H3,(H3,14,15) |
| InChIKey | LSQYYEVUOCNVDZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|