C13H17N5S — CID 81054743
2,6-dimethyl-4-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridine-3-carboximidamide (PubChem CID 81054743) has the molecular formula C13H17N5S and a molecular weight of 275.38 g/mol. Its IUPAC name is 2,6-dimethyl-4-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridine-3-carboximidamide.
| Compound Name | 2,6-dimethyl-4-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 81054743 |
| Molecular Formula | C13H17N5S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2,6-dimethyl-4-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N(C)Cc2cscn2)cc(C)nc1C |
| InChI | InChI=1S/C13H17N5S/c1-8-4-11(12(13(14)15)9(2)17-8)18(3)5-10-6-19-7-16-10/h4,6-7H,5H2,1-3H3,(H3,14,15) |
| InChIKey | QFLFJNRZLGRKIB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|