C17H30N4 — CID 81037767
2,6-dimethyl-4-[2-methylpropyl(pentan-3-yl)amino]pyridine-3-carboximidamide (PubChem CID 81037767) has the molecular formula C17H30N4 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2-methylpropyl(pentan-3-yl)amino]pyridine-3-carboximidamide.
| Compound Name | 2,6-dimethyl-4-[2-methylpropyl(pentan-3-yl)amino]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 81037767 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 2,6-dimethyl-4-[2-methylpropyl(pentan-3-yl)amino]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N(CC(C)C)C(CC)CC)cc(C)nc1C |
| InChI | InChI=1S/C17H30N4/c1-7-14(8-2)21(10-11(3)4)15-9-12(5)20-13(6)16(15)17(18)19/h9,11,14H,7-8,10H2,1-6H3,(H3,18,19) |
| InChIKey | BGGCOSOQHCPMHR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|