C16H27N3S — CID 81054896
4-[bis(2-methylpropyl)amino]-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81054896) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)amino]-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-[bis(2-methylpropyl)amino]-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81054896 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 4-[bis(2-methylpropyl)amino]-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(N(CC(C)C)CC(C)C)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C16H27N3S/c1-10(2)8-19(9-11(3)4)14-7-12(5)18-13(6)15(14)16(17)20/h7,10-11H,8-9H2,1-6H3,(H2,17,20) |
| InChIKey | JEORBIXOWYBTBN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|