C15H26N4S — CID 102993405
4-[3-(dimethylamino)propyl-ethylamino]-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 102993405) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propyl-ethylamino]-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-[3-(dimethylamino)propyl-ethylamino]-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 102993405 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 4-[3-(dimethylamino)propyl-ethylamino]-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | CCN(CCCN(C)C)c1cc(C)nc(C)c1C(N)=S |
| InChI | InChI=1S/C15H26N4S/c1-6-19(9-7-8-18(4)5)13-10-11(2)17-12(3)14(13)15(16)20/h10H,6-9H2,1-5H3,(H2,16,20) |
| InChIKey | MNHYVAYJUQOPDD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|