C16H18FN3S — CID 81060052
4-(N-ethyl-2-fluoroanilino)-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81060052) has the molecular formula C16H18FN3S and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-(N-ethyl-2-fluoroanilino)-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-(N-ethyl-2-fluoroanilino)-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81060052 |
| Molecular Formula | C16H18FN3S |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-(N-ethyl-2-fluoroanilino)-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | CCN(c1ccccc1F)c1cc(C)nc(C)c1C(N)=S |
| InChI | InChI=1S/C16H18FN3S/c1-4-20(13-8-6-5-7-12(13)17)14-9-10(2)19-11(3)15(14)16(18)21/h5-9H,4H2,1-3H3,(H2,18,21) |
| InChIKey | QNOOWPTXISNORD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|