C14H23N3OS — CID 107199799
4-[5-hydroxypentyl(methyl)amino]-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 107199799) has the molecular formula C14H23N3OS and a molecular weight of 281.43 g/mol. Its IUPAC name is 4-[5-hydroxypentyl(methyl)amino]-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-[5-hydroxypentyl(methyl)amino]-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107199799 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-[5-hydroxypentyl(methyl)amino]-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(N(C)CCCCCO)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C14H23N3OS/c1-10-9-12(13(14(15)19)11(2)16-10)17(3)7-5-4-6-8-18/h9,18H,4-8H2,1-3H3,(H2,15,19) |
| InChIKey | VMGZUVLNLGQPQK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|