C13H16N4S — CID 55013685
2-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]benzenecarboximidamide (PubChem CID 55013685) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]benzenecarboximidamide.
| Compound Name | 2-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 55013685 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1CN(C)Cc1cscn1 |
| InChI | InChI=1S/C13H16N4S/c1-17(7-11-8-18-9-16-11)6-10-4-2-3-5-12(10)13(14)15/h2-5,8-9H,6-7H2,1H3,(H3,14,15) |
| InChIKey | OIJUUUVRTJKNSJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|