C17H18BrNO2S — CID 20992906
5-bromo-2-[2-(2,4-dimethylphenoxy)ethoxy]benzenecarbothioamide (PubChem CID 20992906) has the molecular formula C17H18BrNO2S and a molecular weight of 380.31 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,4-dimethylphenoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[2-(2,4-dimethylphenoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 20992906 |
| Molecular Formula | C17H18BrNO2S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 5-bromo-2-[2-(2,4-dimethylphenoxy)ethoxy]benzenecarbothioamide |
| SMILES | Cc1ccc(OCCOc2ccc(Br)cc2C(N)=S)c(C)c1 |
| InChI | InChI=1S/C17H18BrNO2S/c1-11-3-5-15(12(2)9-11)20-7-8-21-16-6-4-13(18)10-14(16)17(19)22/h3-6,9-10H,7-8H2,1-2H3,(H2,19,22) |
| InChIKey | FJKOYHFUSSJQBP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|