C11H14BrNO3S2 — CID 83144929
5-bromo-2-(2-ethylsulfonylethoxy)benzenecarbothioamide (PubChem CID 83144929) has the molecular formula C11H14BrNO3S2 and a molecular weight of 352.28 g/mol. Its IUPAC name is 5-bromo-2-(2-ethylsulfonylethoxy)benzenecarbothioamide.
| Compound Name | 5-bromo-2-(2-ethylsulfonylethoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 83144929 |
| Molecular Formula | C11H14BrNO3S2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 5-bromo-2-(2-ethylsulfonylethoxy)benzenecarbothioamide |
| SMILES | CCS(=O)(=O)CCOc1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C11H14BrNO3S2/c1-2-18(14,15)6-5-16-10-4-3-8(12)7-9(10)11(13)17/h3-4,7H,2,5-6H2,1H3,(H2,13,17) |
| InChIKey | AJYUAWDZIUFOJP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|