C31H11BF15O- — CID 102345548
tris(2,3,4,5,6-pentafluorophenyl)-(4-phenylmethoxyphenyl)boranuide (PubChem CID 102345548) has the molecular formula C31H11BF15O- and a molecular weight of 695.21 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-(4-phenylmethoxyphenyl)boranuide.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-(4-phenylmethoxyphenyl)boranuide |
|---|---|
| PubChem CID | 102345548 |
| Molecular Formula | C31H11BF15O- |
| Molecular Weight | 695.21 g/mol |
| Exact Mass | 695.07 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-(4-phenylmethoxyphenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2ccc(OCc3ccccc3)cc2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C31H11BF15O/c33-17-14(18(34)24(40)29(45)23(17)39)32(15-19(35)25(41)30(46)26(42)20(15)36,16-21(37)27(43)31(47)28(44)22(16)38)12-6-8-13(9-7-12)48-10-11-4-2-1-3-5-11/h1-9H,10H2/q-1 |
| InChIKey | QHGTWBVFHQZVIG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.21 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|