C24H15BF5Na — CID 139835857
sodium (2,3,4,5,6-pentafluorophenyl)-triphenylboranuide (PubChem CID 139835857) has the molecular formula C24H15BF5Na and a molecular weight of 432.18 g/mol. Its IUPAC name is sodium (2,3,4,5,6-pentafluorophenyl)-triphenylboranuide.
| Compound Name | sodium (2,3,4,5,6-pentafluorophenyl)-triphenylboranuide |
|---|---|
| PubChem CID | 139835857 |
| Molecular Formula | C24H15BF5Na |
| Molecular Weight | 432.18 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | sodium (2,3,4,5,6-pentafluorophenyl)-triphenylboranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1F.[Na+] |
| InChI | InChI=1S/C24H15BF5.Na/c26-20-19(21(27)23(29)24(30)22(20)28)25(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;/q-1;+1 |
| InChIKey | JSGRHZLCMRTEDR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|