About tetraphenylboranuide tetrafluoroborate
tetraphenylboranuide tetrafluoroborate (PubChem CID 87564099) has the molecular formula C24H20B2F4-2
and a molecular weight of 406.04 g/mol. Its IUPAC name is tetraphenylboranuide tetrafluoroborate.
Molecular Properties
| Compound Name | tetraphenylboranuide tetrafluoroborate |
| PubChem CID | 87564099 |
| Molecular Formula | C24H20B2F4-2 |
| Molecular Weight | 406.04 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | tetraphenylboranuide tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.BF4/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3,4)5/h1-20H;/q2*-1 |
| InChIKey | MDGVFSIZYYFQBN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.04 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetraphenylboranuide tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraphenylboranuide tetrafluoroborate?
The IUPAC name of tetraphenylboranuide tetrafluoroborate (CID 87564099) is tetraphenylboranuide tetrafluoroborate.
What is the SMILES notation for tetraphenylboranuide tetrafluoroborate?
The canonical SMILES for tetraphenylboranuide tetrafluoroborate is F[B-](F)(F)F.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetraphenylboranuide tetrafluoroborate?
The InChIKey is MDGVFSIZYYFQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.BF4/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3,4)5/h1-20H;/q2*-1.
What are the key properties of tetraphenylboranuide tetrafluoroborate?
tetraphenylboranuide tetrafluoroborate has a molecular weight of 406.04 g/mol, XLogP of 4.36, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraphenylboranuide tetrafluoroborate is sourced from PubChem (CID 87564099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).