About sodium tetraphenylboranuide
sodium tetraphenylboranuide (PubChem CID 2723787) has the molecular formula C24H20BNa
and a molecular weight of 342.23 g/mol. Its IUPAC name is sodium tetraphenylboranuide.
Molecular Properties
| Compound Name | sodium tetraphenylboranuide |
| PubChem CID | 2723787 |
| Molecular Formula | C24H20BNa |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | sodium tetraphenylboranuide |
| SMILES | [Na+].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.Na/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;/q-1;+1 |
| InChIKey | HFSRCEJMTLMDLI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium tetraphenylboranuide?
The IUPAC name of sodium tetraphenylboranuide (CID 2723787) is sodium tetraphenylboranuide.
What is the SMILES notation for sodium tetraphenylboranuide?
The canonical SMILES for sodium tetraphenylboranuide is [Na+].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of sodium tetraphenylboranuide?
The InChIKey is HFSRCEJMTLMDLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.Na/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;/q-1;+1.
What are the key properties of sodium tetraphenylboranuide?
sodium tetraphenylboranuide has a molecular weight of 342.23 g/mol, XLogP of 0.07, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium tetraphenylboranuide is sourced from PubChem (CID 2723787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).