C28H17BF15N — CID 11498397
tetramethylazanium;tris(2,3,4,5,6-pentafluorophenyl)-phenylboranuide (PubChem CID 11498397) has the molecular formula C28H17BF15N and a molecular weight of 663.23 g/mol. Its IUPAC name is tetramethylazanium;tris(2,3,4,5,6-pentafluorophenyl)-phenylboranuide.
| Compound Name | tetramethylazanium;tris(2,3,4,5,6-pentafluorophenyl)-phenylboranuide |
|---|---|
| PubChem CID | 11498397 |
| Molecular Formula | C28H17BF15N |
| Molecular Weight | 663.23 g/mol |
| Exact Mass | 663.12 |
| IUPAC Name | tetramethylazanium;tris(2,3,4,5,6-pentafluorophenyl)-phenylboranuide |
| SMILES | C[N+](C)(C)C.Fc1c(F)c(F)c([B-](c2ccccc2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24H5BF15.C4H12N/c26-10-7(11(27)17(33)22(38)16(10)32)25(6-4-2-1-3-5-6,8-12(28)18(34)23(39)19(35)13(8)29)9-14(30)20(36)24(40)21(37)15(9)31;1-5(2,3)4/h1-5H;1-4H3/q-1;+1 |
| InChIKey | FKIPVTJEIJGBEX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.23 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|