C33H19BF15NO — CID 139950647
benzyl(dimethyl)azanium;(4-hydroxyphenyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139950647) has the molecular formula C33H19BF15NO and a molecular weight of 741.30 g/mol. Its IUPAC name is benzyl(dimethyl)azanium;(4-hydroxyphenyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | benzyl(dimethyl)azanium;(4-hydroxyphenyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139950647 |
| Molecular Formula | C33H19BF15NO |
| Molecular Weight | 741.30 g/mol |
| Exact Mass | 741.13 |
| IUPAC Name | benzyl(dimethyl)azanium;(4-hydroxyphenyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C[NH+](C)Cc1ccccc1.Oc1ccc([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H5BF15O.C9H13N/c26-10-7(11(27)17(33)22(38)16(10)32)25(5-1-3-6(41)4-2-5,8-12(28)18(34)23(39)19(35)13(8)29)9-14(30)20(36)24(40)21(37)15(9)31;1-10(2)8-9-6-4-3-5-7-9/h1-4,41H;3-7H,8H2,1-2H3/q-1;/p+1 |
| InChIKey | OJBXIXKZARNEOX-UHFFFAOYSA-O |
| XLogP | 5.19 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|