About benzyl(dimethyl)azanium phenoxide
benzyl(dimethyl)azanium phenoxide (PubChem CID 88771722) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is benzyl(dimethyl)azanium phenoxide.
Molecular Properties
| Compound Name | benzyl(dimethyl)azanium phenoxide |
| PubChem CID | 88771722 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | benzyl(dimethyl)azanium phenoxide |
| SMILES | C[NH+](C)Cc1ccccc1.[O-]c1ccccc1 |
| InChI | InChI=1S/C9H13N.C6H6O/c1-10(2)8-9-6-4-3-5-7-9;7-6-4-2-1-3-5-6/h3-7H,8H2,1-2H3;1-5,7H |
| InChIKey | FZSGNFPQLLIVJV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzyl(dimethyl)azanium phenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(dimethyl)azanium phenoxide?
The IUPAC name of benzyl(dimethyl)azanium phenoxide (CID 88771722) is benzyl(dimethyl)azanium phenoxide.
What is the SMILES notation for benzyl(dimethyl)azanium phenoxide?
The canonical SMILES for benzyl(dimethyl)azanium phenoxide is C[NH+](C)Cc1ccccc1.[O-]c1ccccc1.
What is the InChIKey of benzyl(dimethyl)azanium phenoxide?
The InChIKey is FZSGNFPQLLIVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C6H6O/c1-10(2)8-9-6-4-3-5-7-9;7-6-4-2-1-3-5-6/h3-7H,8H2,1-2H3;1-5,7H.
What are the key properties of benzyl(dimethyl)azanium phenoxide?
benzyl(dimethyl)azanium phenoxide has a molecular weight of 229.32 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(dimethyl)azanium phenoxide is sourced from PubChem (CID 88771722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).