About benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide
benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide (PubChem CID 87935585) has the molecular formula C37H34BF8N
and a molecular weight of 655.48 g/mol. Its IUPAC name is benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide.
Molecular Properties
| Compound Name | benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide |
| PubChem CID | 87935585 |
| Molecular Formula | C37H34BF8N |
| Molecular Weight | 655.48 g/mol |
| Exact Mass | 655.27 |
| IUPAC Name | benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide |
| SMILES | C[NH+](C)Cc1ccccc1.Cc1ccc(F)c([B-](c2c(F)ccc(C)c2F)(c2c(F)ccc(C)c2F)c2c(F)ccc(C)c2F)c1F |
| InChI | InChI=1S/C28H20BF8.C9H13N/c1-13-5-9-17(30)21(25(13)34)29(22-18(31)10-6-14(2)26(22)35,23-19(32)11-7-15(3)27(23)36)24-20(33)12-8-16(4)28(24)37;1-10(2)8-9-6-4-3-5-7-9/h5-12H,1-4H3;3-7H,8H2,1-2H3/q-1;/p+1 |
| InChIKey | IJWFYYJAULBTLI-UHFFFAOYSA-O |
| XLogP | 5.74 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 655.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide?
The IUPAC name of benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide (CID 87935585) is benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide.
What is the SMILES notation for benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide?
The canonical SMILES for benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide is C[NH+](C)Cc1ccccc1.Cc1ccc(F)c([B-](c2c(F)ccc(C)c2F)(c2c(F)ccc(C)c2F)c2c(F)ccc(C)c2F)c1F.
What is the InChIKey of benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide?
The InChIKey is IJWFYYJAULBTLI-UHFFFAOYSA-O. The full InChI is InChI=1S/C28H20BF8.C9H13N/c1-13-5-9-17(30)21(25(13)34)29(22-18(31)10-6-14(2)26(22)35,23-19(32)11-7-15(3)27(23)36)24-20(33)12-8-16(4)28(24)37;1-10(2)8-9-6-4-3-5-7-9/h5-12H,1-4H3;3-7H,8H2,1-2H3/q-1;/p+1.
What are the key properties of benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide?
benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide has a molecular weight of 655.48 g/mol, XLogP of 5.74, 6 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide is sourced from PubChem (CID 87935585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).