C37H34BF8N — CID 87935585
benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide (PubChem CID 87935585) has the molecular formula C37H34BF8N and a molecular weight of 655.48 g/mol. Its IUPAC name is benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide.
| Compound Name | benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide |
|---|---|
| PubChem CID | 87935585 |
| Molecular Formula | C37H34BF8N |
| Molecular Weight | 655.48 g/mol |
| Exact Mass | 655.27 |
| IUPAC Name | benzyl(dimethyl)azanium;tetrakis(2,6-difluoro-3-methylphenyl)boranuide |
| SMILES | C[NH+](C)Cc1ccccc1.Cc1ccc(F)c([B-](c2c(F)ccc(C)c2F)(c2c(F)ccc(C)c2F)c2c(F)ccc(C)c2F)c1F |
| InChI | InChI=1S/C28H20BF8.C9H13N/c1-13-5-9-17(30)21(25(13)34)29(22-18(31)10-6-14(2)26(22)35,23-19(32)11-7-15(3)27(23)36)24-20(33)12-8-16(4)28(24)37;1-10(2)8-9-6-4-3-5-7-9/h5-12H,1-4H3;3-7H,8H2,1-2H3/q-1;/p+1 |
| InChIKey | IJWFYYJAULBTLI-UHFFFAOYSA-O |
| XLogP | 5.74 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|