C39H30BF16NO4 — CID 87935462
benzyl(diethyl)azanium;tetrakis(2,3,4,5-tetrafluoro-6-methoxyphenyl)boranuide (PubChem CID 87935462) has the molecular formula C39H30BF16NO4 and a molecular weight of 891.45 g/mol. Its IUPAC name is benzyl(diethyl)azanium;tetrakis(2,3,4,5-tetrafluoro-6-methoxyphenyl)boranuide.
| Compound Name | benzyl(diethyl)azanium;tetrakis(2,3,4,5-tetrafluoro-6-methoxyphenyl)boranuide |
|---|---|
| PubChem CID | 87935462 |
| Molecular Formula | C39H30BF16NO4 |
| Molecular Weight | 891.45 g/mol |
| Exact Mass | 891.20 |
| IUPAC Name | benzyl(diethyl)azanium;tetrakis(2,3,4,5-tetrafluoro-6-methoxyphenyl)boranuide |
| SMILES | CC[NH+](CC)Cc1ccccc1.COc1c(F)c(F)c(F)c(F)c1[B-](c1c(F)c(F)c(F)c(F)c1OC)(c1c(F)c(F)c(F)c(F)c1OC)c1c(F)c(F)c(F)c(F)c1OC |
| InChI | InChI=1S/C28H12BF16O4.C11H17N/c1-46-25-5(9(30)13(34)17(38)21(25)42)29(6-10(31)14(35)18(39)22(43)26(6)47-2,7-11(32)15(36)19(40)23(44)27(7)48-3)8-12(33)16(37)20(41)24(45)28(8)49-4;1-3-12(4-2)10-11-8-6-5-7-9-11/h1-4H3;5-9H,3-4,10H2,1-2H3/q-1;/p+1 |
| InChIKey | HFMOMHUGZKVALA-UHFFFAOYSA-O |
| XLogP | 6.44 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.45 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|