C28H12BF16KO4 — CID 139958531
potassium tetrakis(2,3,4,5-tetrafluoro-6-methoxyphenyl)boranuide (PubChem CID 139958531) has the molecular formula C28H12BF16KO4 and a molecular weight of 766.28 g/mol. Its IUPAC name is potassium tetrakis(2,3,4,5-tetrafluoro-6-methoxyphenyl)boranuide.
| Compound Name | potassium tetrakis(2,3,4,5-tetrafluoro-6-methoxyphenyl)boranuide |
|---|---|
| PubChem CID | 139958531 |
| Molecular Formula | C28H12BF16KO4 |
| Molecular Weight | 766.28 g/mol |
| Exact Mass | 766.02 |
| IUPAC Name | potassium tetrakis(2,3,4,5-tetrafluoro-6-methoxyphenyl)boranuide |
| SMILES | COc1c(F)c(F)c(F)c(F)c1[B-](c1c(F)c(F)c(F)c(F)c1OC)(c1c(F)c(F)c(F)c(F)c1OC)c1c(F)c(F)c(F)c(F)c1OC.[K+] |
| InChI | InChI=1S/C28H12BF16O4.K/c1-46-25-5(9(30)13(34)17(38)21(25)42)29(6-10(31)14(35)18(39)22(43)26(6)47-2,7-11(32)15(36)19(40)23(44)27(7)48-3)8-12(33)16(37)20(41)24(45)28(8)49-4;/h1-4H3;/q-1;+1 |
| InChIKey | GZBTZHJNEABYGC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|