C24BClF20Mg — CID 175877855
magnesium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;chloride (PubChem CID 175877855) has the molecular formula C24BClF20Mg and a molecular weight of 738.79 g/mol. Its IUPAC name is magnesium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;chloride.
| Compound Name | magnesium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;chloride |
|---|---|
| PubChem CID | 175877855 |
| Molecular Formula | C24BClF20Mg |
| Molecular Weight | 738.79 g/mol |
| Exact Mass | 737.93 |
| IUPAC Name | magnesium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;chloride |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.[Cl-].[Mg+2] |
| InChI | InChI=1S/C24BF20.ClH.Mg/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;;/h;1H;/q-1;;+2/p-1 |
| InChIKey | BIICNYDUXNGLHR-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.79 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|