C48B2F40Ru — CID 140502353
ruthenium(2+);bis(tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide) (PubChem CID 140502353) has the molecular formula C48B2F40Ru and a molecular weight of 1459.14 g/mol. Its IUPAC name is ruthenium(2+);bis(tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide).
| Compound Name | ruthenium(2+);bis(tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide) |
|---|---|
| PubChem CID | 140502353 |
| Molecular Formula | C48B2F40Ru |
| Molecular Weight | 1459.14 g/mol |
| Exact Mass | 1459.86 |
| IUPAC Name | ruthenium(2+);bis(tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide) |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.[Ru+2] |
| InChI | InChI=1S/2C24BF20.Ru/c2*26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;/q2*-1;+2 |
| InChIKey | FYQHPORIXMGCED-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1459.14 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|