C27H8BF21OS — CID 139728016
fluoromethoxy(dimethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139728016) has the molecular formula C27H8BF21OS and a molecular weight of 790.20 g/mol. Its IUPAC name is fluoromethoxy(dimethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | fluoromethoxy(dimethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139728016 |
| Molecular Formula | C27H8BF21OS |
| Molecular Weight | 790.20 g/mol |
| Exact Mass | 790.01 |
| IUPAC Name | fluoromethoxy(dimethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C[S+](C)OCF.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C3H8FOS/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-6(2)5-3-4/h;3H2,1-2H3/q-1;+1 |
| InChIKey | DIACTFYDXFLTOU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.20 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|