C29H13BF20OS — CID 139727441
dimethyl(propan-2-yloxy)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139727441) has the molecular formula C29H13BF20OS and a molecular weight of 800.26 g/mol. Its IUPAC name is dimethyl(propan-2-yloxy)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | dimethyl(propan-2-yloxy)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139727441 |
| Molecular Formula | C29H13BF20OS |
| Molecular Weight | 800.26 g/mol |
| Exact Mass | 800.05 |
| IUPAC Name | dimethyl(propan-2-yloxy)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(C)O[S+](C)C.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C5H13OS/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-5(2)6-7(3)4/h;5H,1-4H3/q-1;+1 |
| InChIKey | LEOADUWSYBHOBT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.26 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|