C30H8BF20NO — CID 139732586
1-methoxypyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139732586) has the molecular formula C30H8BF20NO and a molecular weight of 789.17 g/mol. Its IUPAC name is 1-methoxypyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-methoxypyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139732586 |
| Molecular Formula | C30H8BF20NO |
| Molecular Weight | 789.17 g/mol |
| Exact Mass | 789.04 |
| IUPAC Name | 1-methoxypyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CO[n+]1ccccc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C6H8NO/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-8-7-5-3-2-4-6-7/h;2-6H,1H3/q-1;+1 |
| InChIKey | CEJOEFNUABXZHD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.17 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|