C40H20BF20NO — CID 139730988
1-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]pyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139730988) has the molecular formula C40H20BF20NO and a molecular weight of 921.38 g/mol. Its IUPAC name is 1-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]pyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]pyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139730988 |
| Molecular Formula | C40H20BF20NO |
| Molecular Weight | 921.38 g/mol |
| Exact Mass | 921.13 |
| IUPAC Name | 1-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]pyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(C)(C)Oc1ccc(C[n+]2ccccc2)cc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C16H20NO/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-16(2,3)18-15-9-7-14(8-10-15)13-17-11-5-4-6-12-17/h;4-12H,13H2,1-3H3/q-1;+1 |
| InChIKey | YZUKCHNVYLCECU-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.38 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|