C38H11BF23NO2 — CID 139732267
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;trifluoromethyl 1-benzylpyridin-1-ium-4-carboxylate (PubChem CID 139732267) has the molecular formula C38H11BF23NO2 and a molecular weight of 961.28 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;trifluoromethyl 1-benzylpyridin-1-ium-4-carboxylate.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;trifluoromethyl 1-benzylpyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 139732267 |
| Molecular Formula | C38H11BF23NO2 |
| Molecular Weight | 961.28 g/mol |
| Exact Mass | 961.05 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;trifluoromethyl 1-benzylpyridin-1-ium-4-carboxylate |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(OC(F)(F)F)c1cc[n+](Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24BF20.C14H11F3NO2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;15-14(16,17)20-13(19)12-6-8-18(9-7-12)10-11-4-2-1-3-5-11/h;1-9H,10H2/q-1;+1 |
| InChIKey | LGIWNKGXROJEOD-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.28 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|