C39H13BF21NO2 — CID 139731486
2-[4-(2-fluoroacetyl)pyridin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139731486) has the molecular formula C39H13BF21NO2 and a molecular weight of 937.31 g/mol. Its IUPAC name is 2-[4-(2-fluoroacetyl)pyridin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-[4-(2-fluoroacetyl)pyridin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139731486 |
| Molecular Formula | C39H13BF21NO2 |
| Molecular Weight | 937.31 g/mol |
| Exact Mass | 937.07 |
| IUPAC Name | 2-[4-(2-fluoroacetyl)pyridin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(CF)c1cc[n+](CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24BF20.C15H13FNO2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;16-10-14(18)13-6-8-17(9-7-13)11-15(19)12-4-2-1-3-5-12/h;1-9H,10-11H2/q-1;+1 |
| InChIKey | FLRWOKTUEIVDDB-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.31 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|