C38H12BF21N2O3 — CID 139735269
fluoromethyl 4-phenacylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139735269) has the molecular formula C38H12BF21N2O3 and a molecular weight of 954.29 g/mol. Its IUPAC name is fluoromethyl 4-phenacylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | fluoromethyl 4-phenacylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139735269 |
| Molecular Formula | C38H12BF21N2O3 |
| Molecular Weight | 954.29 g/mol |
| Exact Mass | 954.06 |
| IUPAC Name | fluoromethyl 4-phenacylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccnc(C(=O)OCF)c1)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C14H12FN2O3/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;15-10-20-14(19)12-8-17(7-6-16-12)9-13(18)11-4-2-1-3-5-11/h;1-8H,9-10H2/q-1;+1 |
| InChIKey | FLGMJGLSCMAHOF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.29 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|