C55H21BF20N2O3 — CID 139736036
tetracen-5-yl 4-phenacylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139736036) has the molecular formula C55H21BF20N2O3 and a molecular weight of 1148.56 g/mol. Its IUPAC name is tetracen-5-yl 4-phenacylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | tetracen-5-yl 4-phenacylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139736036 |
| Molecular Formula | C55H21BF20N2O3 |
| Molecular Weight | 1148.56 g/mol |
| Exact Mass | 1148.13 |
| IUPAC Name | tetracen-5-yl 4-phenacylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccnc(C(=O)Oc2c3ccccc3cc3cc4ccccc4cc23)c1)c1ccccc1 |
| InChI | InChI=1S/C31H21N2O3.C24BF20/c34-29(21-8-2-1-3-9-21)20-33-15-14-32-28(19-33)31(35)36-30-26-13-7-6-12-24(26)17-25-16-22-10-4-5-11-23(22)18-27(25)30;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-19H,20H2;/q+1;-1 |
| InChIKey | ZPGAIGVMMRXQGZ-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1148.56 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|