C37H12BClF20N2O2 — CID 139738557
2-[3-(chloromethoxy)pyrazin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139738557) has the molecular formula C37H12BClF20N2O2 and a molecular weight of 942.74 g/mol. Its IUPAC name is 2-[3-(chloromethoxy)pyrazin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-[3-(chloromethoxy)pyrazin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139738557 |
| Molecular Formula | C37H12BClF20N2O2 |
| Molecular Weight | 942.74 g/mol |
| Exact Mass | 942.04 |
| IUPAC Name | 2-[3-(chloromethoxy)pyrazin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccnc(OCCl)c1)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C13H12ClN2O2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;14-10-18-13-9-16(7-6-15-13)8-12(17)11-4-2-1-3-5-11/h;1-7,9H,8,10H2/q-1;+1 |
| InChIKey | VHDGYUVGRDIGRR-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.74 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|