About tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate
tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate (PubChem CID 139731194) has the molecular formula C14H11Br3NO2+
and a molecular weight of 464.96 g/mol. Its IUPAC name is tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate.
Molecular Properties
| Compound Name | tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate |
| PubChem CID | 139731194 |
| Molecular Formula | C14H11Br3NO2+ |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 461.83 |
| IUPAC Name | tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate |
| SMILES | O=C(OC(Br)(Br)Br)c1cc[n+](Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H11Br3NO2/c15-14(16,17)20-13(19)12-6-8-18(9-7-12)10-11-4-2-1-3-5-11/h1-9H,10H2/q+1 |
| InChIKey | XRQIAYONVXQZJC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate?
The IUPAC name of tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate (CID 139731194) is tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate.
What is the SMILES notation for tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate?
The canonical SMILES for tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate is O=C(OC(Br)(Br)Br)c1cc[n+](Cc2ccccc2)cc1.
What is the InChIKey of tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate?
The InChIKey is XRQIAYONVXQZJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Br3NO2/c15-14(16,17)20-13(19)12-6-8-18(9-7-12)10-11-4-2-1-3-5-11/h1-9H,10H2/q+1.
What are the key properties of tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate?
tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate has a molecular weight of 464.96 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tribromomethyl 1-benzylpyridin-1-ium-4-carboxylate is sourced from PubChem (CID 139731194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).