About 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide
1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide (PubChem CID 135882393) has the molecular formula C13H14BrN3O
and a molecular weight of 308.18 g/mol. Its IUPAC name is 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide.
Molecular Properties
| Compound Name | 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide |
| PubChem CID | 135882393 |
| Molecular Formula | C13H14BrN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide |
| SMILES | N/C(=N\O)c1cc[n+](Cc2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C13H13N3O.BrH/c14-13(15-17)12-6-8-16(9-7-12)10-11-4-2-1-3-5-11;/h1-9H,10,14H2;1H |
| InChIKey | RTRAEFRWWLLKQO-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 62.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide?
The IUPAC name of 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide (CID 135882393) is 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide.
What is the SMILES notation for 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide?
The canonical SMILES for 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide is N/C(=N\O)c1cc[n+](Cc2ccccc2)cc1.[Br-].
What is the InChIKey of 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide?
The InChIKey is RTRAEFRWWLLKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O.BrH/c14-13(15-17)12-6-8-16(9-7-12)10-11-4-2-1-3-5-11;/h1-9H,10,14H2;1H.
What are the key properties of 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide?
1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide has a molecular weight of 308.18 g/mol, XLogP of -1.88, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N'-hydroxypyridin-1-ium-4-carboximidamide bromide is sourced from PubChem (CID 135882393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).