About N'-hydroxybenzenecarboximidamide;pentahydrate
N'-hydroxybenzenecarboximidamide;pentahydrate (PubChem CID 174367022) has the molecular formula C7H18N2O6
and a molecular weight of 226.23 g/mol. Its IUPAC name is N'-hydroxybenzenecarboximidamide;pentahydrate.
Molecular Properties
| Compound Name | N'-hydroxybenzenecarboximidamide;pentahydrate |
| PubChem CID | 174367022 |
| Molecular Formula | C7H18N2O6 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N'-hydroxybenzenecarboximidamide;pentahydrate |
| SMILES | NC(=NO)c1ccccc1.O.O.O.O.O |
| InChI | InChI=1S/C7H8N2O.5H2O/c8-7(9-10)6-4-2-1-3-5-6;;;;;/h1-5,10H,(H2,8,9);5*1H2 |
| InChIKey | QKJRGKKRQJMZAL-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 216.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxybenzenecarboximidamide;pentahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxybenzenecarboximidamide;pentahydrate?
The IUPAC name of N'-hydroxybenzenecarboximidamide;pentahydrate (CID 174367022) is N'-hydroxybenzenecarboximidamide;pentahydrate.
What is the SMILES notation for N'-hydroxybenzenecarboximidamide;pentahydrate?
The canonical SMILES for N'-hydroxybenzenecarboximidamide;pentahydrate is NC(=NO)c1ccccc1.O.O.O.O.O.
What is the InChIKey of N'-hydroxybenzenecarboximidamide;pentahydrate?
The InChIKey is QKJRGKKRQJMZAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.5H2O/c8-7(9-10)6-4-2-1-3-5-6;;;;;/h1-5,10H,(H2,8,9);5*1H2.
What are the key properties of N'-hydroxybenzenecarboximidamide;pentahydrate?
N'-hydroxybenzenecarboximidamide;pentahydrate has a molecular weight of 226.23 g/mol, XLogP of -3.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxybenzenecarboximidamide;pentahydrate is sourced from PubChem (CID 174367022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).