About N'-cyanobenzenecarboximidamide;hydrochloride
N'-cyanobenzenecarboximidamide;hydrochloride (PubChem CID 75485318) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is N'-cyanobenzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-cyanobenzenecarboximidamide;hydrochloride |
| PubChem CID | 75485318 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | N'-cyanobenzenecarboximidamide;hydrochloride |
| SMILES | Cl.N#C/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C8H7N3.ClH/c9-6-11-8(10)7-4-2-1-3-5-7;/h1-5H,(H2,10,11);1H |
| InChIKey | JDDZWLVUXIEGEU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-cyanobenzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyanobenzenecarboximidamide;hydrochloride?
The IUPAC name of N'-cyanobenzenecarboximidamide;hydrochloride (CID 75485318) is N'-cyanobenzenecarboximidamide;hydrochloride.
What is the SMILES notation for N'-cyanobenzenecarboximidamide;hydrochloride?
The canonical SMILES for N'-cyanobenzenecarboximidamide;hydrochloride is Cl.N#C/N=C(\N)c1ccccc1.
What is the InChIKey of N'-cyanobenzenecarboximidamide;hydrochloride?
The InChIKey is JDDZWLVUXIEGEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.ClH/c9-6-11-8(10)7-4-2-1-3-5-7;/h1-5H,(H2,10,11);1H.
What are the key properties of N'-cyanobenzenecarboximidamide;hydrochloride?
N'-cyanobenzenecarboximidamide;hydrochloride has a molecular weight of 181.63 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyanobenzenecarboximidamide;hydrochloride is sourced from PubChem (CID 75485318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).