About ethene;N'-methylbenzenecarboximidamide
ethene;N'-methylbenzenecarboximidamide (PubChem CID 142294327) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is ethene;N'-methylbenzenecarboximidamide.
Molecular Properties
| Compound Name | ethene;N'-methylbenzenecarboximidamide |
| PubChem CID | 142294327 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | ethene;N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1ccccc1.C=C |
| InChI | InChI=1S/C8H10N2.C2H4/c1-10-8(9)7-5-3-2-4-6-7;1-2/h2-6H,1H3,(H2,9,10);1-2H2 |
| InChIKey | HGXKJTKNBZJNSO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;N'-methylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;N'-methylbenzenecarboximidamide?
The IUPAC name of ethene;N'-methylbenzenecarboximidamide (CID 142294327) is ethene;N'-methylbenzenecarboximidamide.
What is the SMILES notation for ethene;N'-methylbenzenecarboximidamide?
The canonical SMILES for ethene;N'-methylbenzenecarboximidamide is C/N=C(\N)c1ccccc1.C=C.
What is the InChIKey of ethene;N'-methylbenzenecarboximidamide?
The InChIKey is HGXKJTKNBZJNSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.C2H4/c1-10-8(9)7-5-3-2-4-6-7;1-2/h2-6H,1H3,(H2,9,10);1-2H2.
What are the key properties of ethene;N'-methylbenzenecarboximidamide?
ethene;N'-methylbenzenecarboximidamide has a molecular weight of 162.24 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;N'-methylbenzenecarboximidamide is sourced from PubChem (CID 142294327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).