About benzamide;ethene
benzamide;ethene (PubChem CID 143479548) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is benzamide;ethene.
Molecular Properties
| Compound Name | benzamide;ethene |
| PubChem CID | 143479548 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | benzamide;ethene |
| SMILES | C=C.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO.C2H4/c8-7(9)6-4-2-1-3-5-6;1-2/h1-5H,(H2,8,9);1-2H2 |
| InChIKey | JRPVBDKOURHEGK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzamide;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;ethene?
The IUPAC name of benzamide;ethene (CID 143479548) is benzamide;ethene.
What is the SMILES notation for benzamide;ethene?
The canonical SMILES for benzamide;ethene is C=C.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;ethene?
The InChIKey is JRPVBDKOURHEGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C2H4/c8-7(9)6-4-2-1-3-5-6;1-2/h1-5H,(H2,8,9);1-2H2.
What are the key properties of benzamide;ethene?
benzamide;ethene has a molecular weight of 149.19 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;ethene is sourced from PubChem (CID 143479548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).