About dipotassium;benzamide;carbonate
dipotassium;benzamide;carbonate (PubChem CID 159256468) has the molecular formula C8H7K2NO4
and a molecular weight of 259.34 g/mol. Its IUPAC name is dipotassium;benzamide;carbonate.
Molecular Properties
| Compound Name | dipotassium;benzamide;carbonate |
| PubChem CID | 159256468 |
| Molecular Formula | C8H7K2NO4 |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | dipotassium;benzamide;carbonate |
| SMILES | NC(=O)c1ccccc1.O=C([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C7H7NO.CH2O3.2K/c8-7(9)6-4-2-1-3-5-6;2-1(3)4;;/h1-5H,(H2,8,9);(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | KVYOUGNYACBOBD-UHFFFAOYSA-L |
| XLogP | -7.65 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | -7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dipotassium;benzamide;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;benzamide;carbonate?
The IUPAC name of dipotassium;benzamide;carbonate (CID 159256468) is dipotassium;benzamide;carbonate.
What is the SMILES notation for dipotassium;benzamide;carbonate?
The canonical SMILES for dipotassium;benzamide;carbonate is NC(=O)c1ccccc1.O=C([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;benzamide;carbonate?
The InChIKey is KVYOUGNYACBOBD-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H7NO.CH2O3.2K/c8-7(9)6-4-2-1-3-5-6;2-1(3)4;;/h1-5H,(H2,8,9);(H2,2,3,4);;/q;;2*+1/p-2.
What are the key properties of dipotassium;benzamide;carbonate?
dipotassium;benzamide;carbonate has a molecular weight of 259.34 g/mol, XLogP of -7.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;benzamide;carbonate is sourced from PubChem (CID 159256468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).