About acetyl chloride;benzamide
acetyl chloride;benzamide (PubChem CID 160666659) has the molecular formula C9H10ClNO2
and a molecular weight of 199.64 g/mol. Its IUPAC name is acetyl chloride;benzamide.
Molecular Properties
| Compound Name | acetyl chloride;benzamide |
| PubChem CID | 160666659 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | acetyl chloride;benzamide |
| SMILES | CC(=O)Cl.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO.C2H3ClO/c8-7(9)6-4-2-1-3-5-6;1-2(3)4/h1-5H,(H2,8,9);1H3 |
| InChIKey | RMJUHGYIVAJFIC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze acetyl chloride;benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl chloride;benzamide?
The IUPAC name of acetyl chloride;benzamide (CID 160666659) is acetyl chloride;benzamide.
What is the SMILES notation for acetyl chloride;benzamide?
The canonical SMILES for acetyl chloride;benzamide is CC(=O)Cl.NC(=O)c1ccccc1.
What is the InChIKey of acetyl chloride;benzamide?
The InChIKey is RMJUHGYIVAJFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C2H3ClO/c8-7(9)6-4-2-1-3-5-6;1-2(3)4/h1-5H,(H2,8,9);1H3.
What are the key properties of acetyl chloride;benzamide?
acetyl chloride;benzamide has a molecular weight of 199.64 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl chloride;benzamide is sourced from PubChem (CID 160666659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).