About benzamide;1,1-dichlorocyclopropane
benzamide;1,1-dichlorocyclopropane (PubChem CID 175468007) has the molecular formula C10H11Cl2NO
and a molecular weight of 232.11 g/mol. Its IUPAC name is benzamide;1,1-dichlorocyclopropane.
Molecular Properties
| Compound Name | benzamide;1,1-dichlorocyclopropane |
| PubChem CID | 175468007 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | benzamide;1,1-dichlorocyclopropane |
| SMILES | ClC1(Cl)CC1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO.C3H4Cl2/c8-7(9)6-4-2-1-3-5-6;4-3(5)1-2-3/h1-5H,(H2,8,9);1-2H2 |
| InChIKey | CMVOUIYLFMXMIU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze benzamide;1,1-dichlorocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;1,1-dichlorocyclopropane?
The IUPAC name of benzamide;1,1-dichlorocyclopropane (CID 175468007) is benzamide;1,1-dichlorocyclopropane.
What is the SMILES notation for benzamide;1,1-dichlorocyclopropane?
The canonical SMILES for benzamide;1,1-dichlorocyclopropane is ClC1(Cl)CC1.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;1,1-dichlorocyclopropane?
The InChIKey is CMVOUIYLFMXMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C3H4Cl2/c8-7(9)6-4-2-1-3-5-6;4-3(5)1-2-3/h1-5H,(H2,8,9);1-2H2.
What are the key properties of benzamide;1,1-dichlorocyclopropane?
benzamide;1,1-dichlorocyclopropane has a molecular weight of 232.11 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;1,1-dichlorocyclopropane is sourced from PubChem (CID 175468007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).