About benzamide;cyclopropanecarbonyl chloride
benzamide;cyclopropanecarbonyl chloride (PubChem CID 174284217) has the molecular formula C11H12ClNO2
and a molecular weight of 225.68 g/mol. Its IUPAC name is benzamide;cyclopropanecarbonyl chloride.
Molecular Properties
| Compound Name | benzamide;cyclopropanecarbonyl chloride |
| PubChem CID | 174284217 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | benzamide;cyclopropanecarbonyl chloride |
| SMILES | NC(=O)c1ccccc1.O=C(Cl)C1CC1 |
| InChI | InChI=1S/C7H7NO.C4H5ClO/c8-7(9)6-4-2-1-3-5-6;5-4(6)3-1-2-3/h1-5H,(H2,8,9);3H,1-2H2 |
| InChIKey | FXYGGJWOGPJAEM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze benzamide;cyclopropanecarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;cyclopropanecarbonyl chloride?
The IUPAC name of benzamide;cyclopropanecarbonyl chloride (CID 174284217) is benzamide;cyclopropanecarbonyl chloride.
What is the SMILES notation for benzamide;cyclopropanecarbonyl chloride?
The canonical SMILES for benzamide;cyclopropanecarbonyl chloride is NC(=O)c1ccccc1.O=C(Cl)C1CC1.
What is the InChIKey of benzamide;cyclopropanecarbonyl chloride?
The InChIKey is FXYGGJWOGPJAEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C4H5ClO/c8-7(9)6-4-2-1-3-5-6;5-4(6)3-1-2-3/h1-5H,(H2,8,9);3H,1-2H2.
What are the key properties of benzamide;cyclopropanecarbonyl chloride?
benzamide;cyclopropanecarbonyl chloride has a molecular weight of 225.68 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;cyclopropanecarbonyl chloride is sourced from PubChem (CID 174284217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).