About adamantane-1-carboxylic acid;benzamide
adamantane-1-carboxylic acid;benzamide (PubChem CID 175381809) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is adamantane-1-carboxylic acid;benzamide.
Molecular Properties
| Compound Name | adamantane-1-carboxylic acid;benzamide |
| PubChem CID | 175381809 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | adamantane-1-carboxylic acid;benzamide |
| SMILES | NC(=O)c1ccccc1.O=C(O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H16O2.C7H7NO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;8-7(9)6-4-2-1-3-5-6/h7-9H,1-6H2,(H,12,13);1-5H,(H2,8,9) |
| InChIKey | GLDNIAAEKSZIMN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze adamantane-1-carboxylic acid;benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-1-carboxylic acid;benzamide?
The IUPAC name of adamantane-1-carboxylic acid;benzamide (CID 175381809) is adamantane-1-carboxylic acid;benzamide.
What is the SMILES notation for adamantane-1-carboxylic acid;benzamide?
The canonical SMILES for adamantane-1-carboxylic acid;benzamide is NC(=O)c1ccccc1.O=C(O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of adamantane-1-carboxylic acid;benzamide?
The InChIKey is GLDNIAAEKSZIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2.C7H7NO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;8-7(9)6-4-2-1-3-5-6/h7-9H,1-6H2,(H,12,13);1-5H,(H2,8,9).
What are the key properties of adamantane-1-carboxylic acid;benzamide?
adamantane-1-carboxylic acid;benzamide has a molecular weight of 301.39 g/mol, XLogP of 3.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-1-carboxylic acid;benzamide is sourced from PubChem (CID 175381809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).