About bis(adamantane-1-carboxylic acid);iodobenzene
bis(adamantane-1-carboxylic acid);iodobenzene (PubChem CID 175091348) has the molecular formula C28H37IO4
and a molecular weight of 564.50 g/mol. Its IUPAC name is bis(adamantane-1-carboxylic acid);iodobenzene.
Molecular Properties
| Compound Name | bis(adamantane-1-carboxylic acid);iodobenzene |
| PubChem CID | 175091348 |
| Molecular Formula | C28H37IO4 |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | bis(adamantane-1-carboxylic acid);iodobenzene |
| SMILES | Ic1ccccc1.O=C(O)C12CC3CC(CC(C3)C1)C2.O=C(O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/2C11H16O2.C6H5I/c2*12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;7-6-4-2-1-3-5-6/h2*7-9H,1-6H2,(H,12,13);1-5H |
| InChIKey | ZKMHVSOEIFDBAN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis(adamantane-1-carboxylic acid);iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(adamantane-1-carboxylic acid);iodobenzene?
The IUPAC name of bis(adamantane-1-carboxylic acid);iodobenzene (CID 175091348) is bis(adamantane-1-carboxylic acid);iodobenzene.
What is the SMILES notation for bis(adamantane-1-carboxylic acid);iodobenzene?
The canonical SMILES for bis(adamantane-1-carboxylic acid);iodobenzene is Ic1ccccc1.O=C(O)C12CC3CC(CC(C3)C1)C2.O=C(O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of bis(adamantane-1-carboxylic acid);iodobenzene?
The InChIKey is ZKMHVSOEIFDBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H16O2.C6H5I/c2*12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;7-6-4-2-1-3-5-6/h2*7-9H,1-6H2,(H,12,13);1-5H.
What are the key properties of bis(adamantane-1-carboxylic acid);iodobenzene?
bis(adamantane-1-carboxylic acid);iodobenzene has a molecular weight of 564.50 g/mol, XLogP of 6.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(adamantane-1-carboxylic acid);iodobenzene is sourced from PubChem (CID 175091348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).