C19H23NO — CID 71559523
1-adamantyl(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 71559523) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-adamantyl(1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | 1-adamantyl(1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 71559523 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-adamantyl(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | O=C(N1Cc2ccccc2C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H23NO/c21-18(20-11-16-3-1-2-4-17(16)12-20)19-8-13-5-14(9-19)7-15(6-13)10-19/h1-4,13-15H,5-12H2 |
| InChIKey | GSTJEWFIXZLJGZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |