S-phenyl adamantane-1-carbothioate

C34H40O2S2 — CID 139084175

IUPACS-phenyl adamantane-1-carbothioate
SMILESO=C(Sc1ccccc1)C12CC3CC(CC(C3)C1)C2.O=C(Sc1ccccc1)C12CC3CC(CC(C3)C1)C2
InChIInChI=1S/2C17H20OS/c2*18-16(19-15-4-2-1-3-5-15)17-9-12-6-13(10-17)8-14(7-12)11-17/h2*1-5,12-14H,6-11H2
InChIKeyXSBGNMUWPDPJQS-UHFFFAOYSA-N
MW544.83 g/mol
LogP9.04
Rot. Bonds4

About S-phenyl adamantane-1-carbothioate

S-phenyl adamantane-1-carbothioate (PubChem CID 139084175) has the molecular formula C34H40O2S2 and a molecular weight of 544.83 g/mol. Its IUPAC name is S-phenyl adamantane-1-carbothioate.

Molecular Properties

Compound NameS-phenyl adamantane-1-carbothioate
PubChem CID139084175
Molecular FormulaC34H40O2S2
Molecular Weight544.83 g/mol
Exact Mass544.25
IUPAC NameS-phenyl adamantane-1-carbothioate
SMILESO=C(Sc1ccccc1)C12CC3CC(CC(C3)C1)C2.O=C(Sc1ccccc1)C12CC3CC(CC(C3)C1)C2
InChIInChI=1S/2C17H20OS/c2*18-16(19-15-4-2-1-3-5-15)17-9-12-6-13(10-17)8-14(7-12)11-17/h2*1-5,12-14H,6-11H2
InChIKeyXSBGNMUWPDPJQS-UHFFFAOYSA-N
XLogP9.04
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms38
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500544.83
LogP ≤ 59.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze S-phenyl adamantane-1-carbothioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of S-phenyl adamantane-1-carbothioate?
The IUPAC name of S-phenyl adamantane-1-carbothioate (CID 139084175) is S-phenyl adamantane-1-carbothioate.
What is the SMILES notation for S-phenyl adamantane-1-carbothioate?
The canonical SMILES for S-phenyl adamantane-1-carbothioate is O=C(Sc1ccccc1)C12CC3CC(CC(C3)C1)C2.O=C(Sc1ccccc1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of S-phenyl adamantane-1-carbothioate?
The InChIKey is XSBGNMUWPDPJQS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H20OS/c2*18-16(19-15-4-2-1-3-5-15)17-9-12-6-13(10-17)8-14(7-12)11-17/h2*1-5,12-14H,6-11H2.
What are the key properties of S-phenyl adamantane-1-carbothioate?
S-phenyl adamantane-1-carbothioate has a molecular weight of 544.83 g/mol, XLogP of 9.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl adamantane-1-carbothioate is sourced from PubChem (CID 139084175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).