About acetic acid;adamantane-1-carboxylic acid
acetic acid;adamantane-1-carboxylic acid (PubChem CID 67530595) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is acetic acid;adamantane-1-carboxylic acid.
Molecular Properties
| Compound Name | acetic acid;adamantane-1-carboxylic acid |
| PubChem CID | 67530595 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | acetic acid;adamantane-1-carboxylic acid |
| SMILES | CC(=O)O.O=C(O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H16O2.C2H4O2/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;1-2(3)4/h7-9H,1-6H2,(H,12,13);1H3,(H,3,4) |
| InChIKey | VESNNCMJFQEGMY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;adamantane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;adamantane-1-carboxylic acid?
The IUPAC name of acetic acid;adamantane-1-carboxylic acid (CID 67530595) is acetic acid;adamantane-1-carboxylic acid.
What is the SMILES notation for acetic acid;adamantane-1-carboxylic acid?
The canonical SMILES for acetic acid;adamantane-1-carboxylic acid is CC(=O)O.O=C(O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of acetic acid;adamantane-1-carboxylic acid?
The InChIKey is VESNNCMJFQEGMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2.C2H4O2/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;1-2(3)4/h7-9H,1-6H2,(H,12,13);1H3,(H,3,4).
What are the key properties of acetic acid;adamantane-1-carboxylic acid?
acetic acid;adamantane-1-carboxylic acid has a molecular weight of 240.30 g/mol, XLogP of 2.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;adamantane-1-carboxylic acid is sourced from PubChem (CID 67530595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).