C24H34O2 — CID 156675738
(Z)-1,3-bis(1-adamantyl)-3-hydroxy-2-methylprop-2-en-1-one (PubChem CID 156675738) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (Z)-1,3-bis(1-adamantyl)-3-hydroxy-2-methylprop-2-en-1-one.
| Compound Name | (Z)-1,3-bis(1-adamantyl)-3-hydroxy-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 156675738 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (Z)-1,3-bis(1-adamantyl)-3-hydroxy-2-methylprop-2-en-1-one |
| SMILES | C/C(C(=O)C12CC3CC(CC(C3)C1)C2)=C(/O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H34O2/c1-14(21(25)23-8-15-2-16(9-23)4-17(3-15)10-23)22(26)24-11-18-5-19(12-24)7-20(6-18)13-24/h15-20,25H,2-13H2,1H3/b21-14- |
| InChIKey | URQLUUUYOOTTHK-STZFKDTASA-N |
| XLogP | 5.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|